C18H30N2O2 — CID 22033765
1-[1-(diethoxymethyl)cyclopropyl]-N-(1-phenylethyl)ethane-1,2-diamine (PubChem CID 22033765) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[1-(diethoxymethyl)cyclopropyl]-N-(1-phenylethyl)ethane-1,2-diamine.
| Compound Name | 1-[1-(diethoxymethyl)cyclopropyl]-N-(1-phenylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 22033765 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-[1-(diethoxymethyl)cyclopropyl]-N-(1-phenylethyl)ethane-1,2-diamine |
| SMILES | CCOC(OCC)C1(C(CN)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H30N2O2/c1-4-21-17(22-5-2)18(11-12-18)16(13-19)20-14(3)15-9-7-6-8-10-15/h6-10,14,16-17,20H,4-5,11-13,19H2,1-3H3 |
| InChIKey | VOKPCRAZAWLMSK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|