C11H12Cl2O — CID 13032776
(3,3-dichloro-1-ethoxyprop-2-enyl)benzene (PubChem CID 13032776) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is (3,3-dichloro-1-ethoxyprop-2-enyl)benzene.
| Compound Name | (3,3-dichloro-1-ethoxyprop-2-enyl)benzene |
|---|---|
| PubChem CID | 13032776 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | (3,3-dichloro-1-ethoxyprop-2-enyl)benzene |
| SMILES | CCOC(C=C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H12Cl2O/c1-2-14-10(8-11(12)13)9-6-4-3-5-7-9/h3-8,10H,2H2,1H3 |
| InChIKey | RAYOOCQAZXMWJG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |