C25H32O4 — CID 101398010
(1S,2R,5S,6R)-2,6-diethoxy-1,5-dimethyl-2,6-diphenyl-3,7-dioxabicyclo[3.3.1]nonane (PubChem CID 101398010) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (1S,2R,5S,6R)-2,6-diethoxy-1,5-dimethyl-2,6-diphenyl-3,7-dioxabicyclo[3.3.1]nonane.
| Compound Name | (1S,2R,5S,6R)-2,6-diethoxy-1,5-dimethyl-2,6-diphenyl-3,7-dioxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 101398010 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (1S,2R,5S,6R)-2,6-diethoxy-1,5-dimethyl-2,6-diphenyl-3,7-dioxabicyclo[3.3.1]nonane |
| SMILES | CCO[C@]1(c2ccccc2)OC[C@]2(C)C[C@@]1(C)CO[C@]2(OCC)c1ccccc1 |
| InChI | InChI=1S/C25H32O4/c1-5-26-24(20-13-9-7-10-14-20)22(3)17-23(4,19-28-24)25(27-6-2,29-18-22)21-15-11-8-12-16-21/h7-16H,5-6,17-19H2,1-4H3/t22-,23-,24+,25+/m0/s1 |
| InChIKey | OOCOFYZJDCNPGI-CXSMSNRLSA-N |
| XLogP | 5.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |