C34H62O10Si4 — CID 175210260
[2,6-bis[[dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silyl]oxy]-2-phenyloxasilinan-6-yl]oxy-dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 175210260) has the molecular formula C34H62O10Si4 and a molecular weight of 743.20 g/mol. Its IUPAC name is [2,6-bis[[dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silyl]oxy]-2-phenyloxasilinan-6-yl]oxy-dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | [2,6-bis[[dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silyl]oxy]-2-phenyloxasilinan-6-yl]oxy-dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 175210260 |
| Molecular Formula | C34H62O10Si4 |
| Molecular Weight | 743.20 g/mol |
| Exact Mass | 742.34 |
| IUPAC Name | [2,6-bis[[dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silyl]oxy]-2-phenyloxasilinan-6-yl]oxy-dimethyl-[1-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCC(OCC1CO1)[Si](C)(C)OC1(O[Si](C)(C)C(CC)OCC2CO2)CCC[Si](O[Si](C)(C)C(CC)OCC2CO2)(c2ccccc2)O1 |
| InChI | InChI=1S/C34H62O10Si4/c1-10-31(38-24-27-21-35-27)45(4,5)41-34(42-46(6,7)32(11-2)39-25-28-22-36-28)19-16-20-48(43-34,30-17-14-13-15-18-30)44-47(8,9)33(12-3)40-26-29-23-37-29/h13-15,17-18,27-29,31-33H,10-12,16,19-26H2,1-9H3 |
| InChIKey | ANESXURGZCJOLT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 102.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.20 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|