C29H28Cl2OSi2 — CID 67069023
3,3-bis(chloromethyl)-2,2,6,6-tetraphenyloxadisilinane (PubChem CID 67069023) has the molecular formula C29H28Cl2OSi2 and a molecular weight of 519.62 g/mol. Its IUPAC name is 3,3-bis(chloromethyl)-2,2,6,6-tetraphenyloxadisilinane.
| Compound Name | 3,3-bis(chloromethyl)-2,2,6,6-tetraphenyloxadisilinane |
|---|---|
| PubChem CID | 67069023 |
| Molecular Formula | C29H28Cl2OSi2 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 3,3-bis(chloromethyl)-2,2,6,6-tetraphenyloxadisilinane |
| SMILES | ClC[Si]1(CCl)CCC(c2ccccc2)(c2ccccc2)O[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28Cl2OSi2/c30-23-33(24-31)22-21-29(25-13-5-1-6-14-25,26-15-7-2-8-16-26)32-34(33,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | BMAOLXWFPKPWOP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|