C15H15NO — CID 10823076
5,5-diphenyl-1,2-oxazolidine (PubChem CID 10823076) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 5,5-diphenyl-1,2-oxazolidine.
| Compound Name | 5,5-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 10823076 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 5,5-diphenyl-1,2-oxazolidine |
| SMILES | c1ccc(C2(c3ccccc3)CCNO2)cc1 |
| InChI | InChI=1S/C15H15NO/c1-3-7-13(8-4-1)15(11-12-16-17-15)14-9-5-2-6-10-14/h1-10,16H,11-12H2 |
| InChIKey | XGNIJWGQMHIEKU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |