C15H13N3 — CID 151250872
4,4-diphenyl-1H-1,3,5-triazine (PubChem CID 151250872) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4,4-diphenyl-1H-1,3,5-triazine.
| Compound Name | 4,4-diphenyl-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 151250872 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4,4-diphenyl-1H-1,3,5-triazine |
| SMILES | C1=NC(c2ccccc2)(c2ccccc2)N=CN1 |
| InChI | InChI=1S/C15H13N3/c1-3-7-13(8-4-1)15(17-11-16-12-18-15)14-9-5-2-6-10-14/h1-12H,(H,16,17,18) |
| InChIKey | NSHLNCQIMMRKGT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |