C15H14N2 — CID 87697574
5,5-diphenyl-1,4-dihydroimidazole (PubChem CID 87697574) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 5,5-diphenyl-1,4-dihydroimidazole.
| Compound Name | 5,5-diphenyl-1,4-dihydroimidazole |
|---|---|
| PubChem CID | 87697574 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 5,5-diphenyl-1,4-dihydroimidazole |
| SMILES | C1=NCC(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C15H14N2/c1-3-7-13(8-4-1)15(11-16-12-17-15)14-9-5-2-6-10-14/h1-10,12H,11H2,(H,16,17) |
| InChIKey | LSOMDEUFNGFJPD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |