C21H17ClN2 — CID 139909403
2-(3-chlorophenyl)-5,5-diphenyl-1,4-dihydroimidazole (PubChem CID 139909403) has the molecular formula C21H17ClN2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5,5-diphenyl-1,4-dihydroimidazole.
| Compound Name | 2-(3-chlorophenyl)-5,5-diphenyl-1,4-dihydroimidazole |
|---|---|
| PubChem CID | 139909403 |
| Molecular Formula | C21H17ClN2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-(3-chlorophenyl)-5,5-diphenyl-1,4-dihydroimidazole |
| SMILES | Clc1cccc(C2=NCC(c3ccccc3)(c3ccccc3)N2)c1 |
| InChI | InChI=1S/C21H17ClN2/c22-19-13-7-8-16(14-19)20-23-15-21(24-20,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14H,15H2,(H,23,24) |
| InChIKey | LPYGZKLMYXYBSC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |