C22H17ClN2O — CID 71698058
4-[(3-chlorophenyl)methyl]-2,4-diphenyl-1H-imidazol-5-one (PubChem CID 71698058) has the molecular formula C22H17ClN2O and a molecular weight of 360.84 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-2,4-diphenyl-1H-imidazol-5-one.
| Compound Name | 4-[(3-chlorophenyl)methyl]-2,4-diphenyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 71698058 |
| Molecular Formula | C22H17ClN2O |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-2,4-diphenyl-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccccc2)=NC1(Cc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C22H17ClN2O/c23-19-13-7-8-16(14-19)15-22(18-11-5-2-6-12-18)21(26)24-20(25-22)17-9-3-1-4-10-17/h1-14H,15H2,(H,24,25,26) |
| InChIKey | PWVANDUALYUCOZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |