C23H19ClN2O — CID 71698156
4-[(4-chlorophenyl)methyl]-2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-one (PubChem CID 71698156) has the molecular formula C23H19ClN2O and a molecular weight of 374.87 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-one.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 71698156 |
| Molecular Formula | C23H19ClN2O |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-one |
| SMILES | Cc1ccc(C2=NC(Cc3ccc(Cl)cc3)(c3ccccc3)C(=O)N2)cc1 |
| InChI | InChI=1S/C23H19ClN2O/c1-16-7-11-18(12-8-16)21-25-22(27)23(26-21,19-5-3-2-4-6-19)15-17-9-13-20(24)14-10-17/h2-14H,15H2,1H3,(H,25,26,27) |
| InChIKey | PXMPSIBJHYZCRM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |