C16H14ClN3O — CID 95655641
(4R)-2-amino-4-[(4-chlorophenyl)methyl]-4-phenyl-1H-imidazol-5-one (PubChem CID 95655641) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is (4R)-2-amino-4-[(4-chlorophenyl)methyl]-4-phenyl-1H-imidazol-5-one.
| Compound Name | (4R)-2-amino-4-[(4-chlorophenyl)methyl]-4-phenyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 95655641 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (4R)-2-amino-4-[(4-chlorophenyl)methyl]-4-phenyl-1H-imidazol-5-one |
| SMILES | NC1=N[C@](Cc2ccc(Cl)cc2)(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C16H14ClN3O/c17-13-8-6-11(7-9-13)10-16(12-4-2-1-3-5-12)14(21)19-15(18)20-16/h1-9H,10H2,(H3,18,19,20,21)/t16-/m1/s1 |
| InChIKey | DYAVPIFVRTWXJK-MRXNPFEDSA-N |
| XLogP | 2.22 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |