C10H10ClN — CID 15496703
5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 15496703) has the molecular formula C10H10ClN and a molecular weight of 179.65 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 15496703 |
| Molecular Formula | C10H10ClN |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Clc1cccc(C2=NCCC2)c1 |
| InChI | InChI=1S/C10H10ClN/c11-9-4-1-3-8(7-9)10-5-2-6-12-10/h1,3-4,7H,2,5-6H2 |
| InChIKey | FHVNCODOPTYOJD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |