C12H12ClN — CID 158338449
2-(3-chlorophenyl)-4,5-dimethyl-3H-pyrrole (PubChem CID 158338449) has the molecular formula C12H12ClN and a molecular weight of 205.69 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4,5-dimethyl-3H-pyrrole.
| Compound Name | 2-(3-chlorophenyl)-4,5-dimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 158338449 |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(3-chlorophenyl)-4,5-dimethyl-3H-pyrrole |
| SMILES | CC1=C(C)N=C(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C12H12ClN/c1-8-6-12(14-9(8)2)10-4-3-5-11(13)7-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | GQWJBTFBUOSKCR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |