C16H14ClN — CID 139079674
(2S)-5-(3-chlorophenyl)-2-phenyl-3,4-dihydro-2H-pyrrole (PubChem CID 139079674) has the molecular formula C16H14ClN and a molecular weight of 255.75 g/mol. Its IUPAC name is (2S)-5-(3-chlorophenyl)-2-phenyl-3,4-dihydro-2H-pyrrole.
| Compound Name | (2S)-5-(3-chlorophenyl)-2-phenyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 139079674 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (2S)-5-(3-chlorophenyl)-2-phenyl-3,4-dihydro-2H-pyrrole |
| SMILES | Clc1cccc(C2=N[C@H](c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C16H14ClN/c17-14-8-4-7-13(11-14)16-10-9-15(18-16)12-5-2-1-3-6-12/h1-8,11,15H,9-10H2/t15-/m0/s1 |
| InChIKey | STQTUOHKLFCZMQ-HNNXBMFYSA-N |
| XLogP | 4.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |