C15H14ClN — CID 142175416
5-(3-chlorophenyl)-2-[(E)-pent-1-en-4-ynyl]-3,4-dihydro-2H-pyrrole (PubChem CID 142175416) has the molecular formula C15H14ClN and a molecular weight of 243.74 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-[(E)-pent-1-en-4-ynyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(3-chlorophenyl)-2-[(E)-pent-1-en-4-ynyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 142175416 |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 5-(3-chlorophenyl)-2-[(E)-pent-1-en-4-ynyl]-3,4-dihydro-2H-pyrrole |
| SMILES | C#CC/C=C/C1CCC(c2cccc(Cl)c2)=N1 |
| InChI | InChI=1S/C15H14ClN/c1-2-3-4-8-14-9-10-15(17-14)12-6-5-7-13(16)11-12/h1,4-8,11,14H,3,9-10H2/b8-4+ |
| InChIKey | WZSTWVGBQOZXQI-XBXARRHUSA-N |
| XLogP | 3.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|