C9H7ClN2O2 — CID 13365909
5-(3-chlorophenyl)-3,6-dihydro-1,3,4-oxadiazin-2-one (PubChem CID 13365909) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3,6-dihydro-1,3,4-oxadiazin-2-one.
| Compound Name | 5-(3-chlorophenyl)-3,6-dihydro-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 13365909 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 5-(3-chlorophenyl)-3,6-dihydro-1,3,4-oxadiazin-2-one |
| SMILES | O=C1NN=C(c2cccc(Cl)c2)CO1 |
| InChI | InChI=1S/C9H7ClN2O2/c10-7-3-1-2-6(4-7)8-5-14-9(13)12-11-8/h1-4H,5H2,(H,12,13) |
| InChIKey | ZKOYQRNHTWHUHA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |