3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid

C15H10ClNO3 — CID 118129498

IUPAC3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid
SMILESO=C(O)c1cccc(C2=Nc3ccc(Cl)cc3OC2)c1
InChIInChI=1S/C15H10ClNO3/c16-11-4-5-12-14(7-11)20-8-13(17-12)9-2-1-3-10(6-9)15(18)19/h1-7H,8H2,(H,18,19)
InChIKeyYPDWNLSQOYDUNY-UHFFFAOYSA-N
MW287.70 g/mol
LogP3.55
Rot. Bonds2

About 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid

3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid (PubChem CID 118129498) has the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. Its IUPAC name is 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid.

Molecular Properties

Compound Name3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid
PubChem CID118129498
Molecular FormulaC15H10ClNO3
Molecular Weight287.70 g/mol
Exact Mass287.03
IUPAC Name3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid
SMILESO=C(O)c1cccc(C2=Nc3ccc(Cl)cc3OC2)c1
InChIInChI=1S/C15H10ClNO3/c16-11-4-5-12-14(7-11)20-8-13(17-12)9-2-1-3-10(6-9)15(18)19/h1-7H,8H2,(H,18,19)
InChIKeyYPDWNLSQOYDUNY-UHFFFAOYSA-N
XLogP3.55
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.70
LogP ≤ 53.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid?
The IUPAC name of 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid (CID 118129498) is 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid.
What is the SMILES notation for 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid?
The canonical SMILES for 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid is O=C(O)c1cccc(C2=Nc3ccc(Cl)cc3OC2)c1.
What is the InChIKey of 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid?
The InChIKey is YPDWNLSQOYDUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClNO3/c16-11-4-5-12-14(7-11)20-8-13(17-12)9-2-1-3-10(6-9)15(18)19/h1-7H,8H2,(H,18,19).
What are the key properties of 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid?
3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid has a molecular weight of 287.70 g/mol, XLogP of 3.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid is sourced from PubChem (CID 118129498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).