C15H10ClNO3 — CID 118129498
3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid (PubChem CID 118129498) has the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. Its IUPAC name is 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid.
| Compound Name | 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 118129498 |
| Molecular Formula | C15H10ClNO3 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-(7-chloro-2H-1,4-benzoxazin-3-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(C2=Nc3ccc(Cl)cc3OC2)c1 |
| InChI | InChI=1S/C15H10ClNO3/c16-11-4-5-12-14(7-11)20-8-13(17-12)9-2-1-3-10(6-9)15(18)19/h1-7H,8H2,(H,18,19) |
| InChIKey | YPDWNLSQOYDUNY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |