C21H17NO — CID 118129533
7-methyl-3-(4-phenylphenyl)-2H-1,4-benzoxazine (PubChem CID 118129533) has the molecular formula C21H17NO and a molecular weight of 299.37 g/mol. Its IUPAC name is 7-methyl-3-(4-phenylphenyl)-2H-1,4-benzoxazine.
| Compound Name | 7-methyl-3-(4-phenylphenyl)-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 118129533 |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 7-methyl-3-(4-phenylphenyl)-2H-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)OCC(c1ccc(-c3ccccc3)cc1)=N2 |
| InChI | InChI=1S/C21H17NO/c1-15-7-12-19-21(13-15)23-14-20(22-19)18-10-8-17(9-11-18)16-5-3-2-4-6-16/h2-13H,14H2,1H3 |
| InChIKey | PZESDZGSXCFSHS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |