3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid

C17H12BrNO3 — CID 143217439

IUPAC3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid
SMILESO=C(O)c1cccc(C2=NC=C(c3cccc(Br)c3)OC2)c1
InChIInChI=1S/C17H12BrNO3/c18-14-6-2-4-12(8-14)16-9-19-15(10-22-16)11-3-1-5-13(7-11)17(20)21/h1-9H,10H2,(H,20,21)
InChIKeyKLFPJMCERLAWQU-UHFFFAOYSA-N
MW358.19 g/mol
LogP3.97
Rot. Bonds3

About 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid

3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid (PubChem CID 143217439) has the molecular formula C17H12BrNO3 and a molecular weight of 358.19 g/mol. Its IUPAC name is 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid.

Molecular Properties

Compound Name3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid
PubChem CID143217439
Molecular FormulaC17H12BrNO3
Molecular Weight358.19 g/mol
Exact Mass357.00
IUPAC Name3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid
SMILESO=C(O)c1cccc(C2=NC=C(c3cccc(Br)c3)OC2)c1
InChIInChI=1S/C17H12BrNO3/c18-14-6-2-4-12(8-14)16-9-19-15(10-22-16)11-3-1-5-13(7-11)17(20)21/h1-9H,10H2,(H,20,21)
InChIKeyKLFPJMCERLAWQU-UHFFFAOYSA-N
XLogP3.97
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.19
LogP ≤ 53.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid?
The IUPAC name of 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid (CID 143217439) is 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid.
What is the SMILES notation for 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid?
The canonical SMILES for 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid is O=C(O)c1cccc(C2=NC=C(c3cccc(Br)c3)OC2)c1.
What is the InChIKey of 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid?
The InChIKey is KLFPJMCERLAWQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrNO3/c18-14-6-2-4-12(8-14)16-9-19-15(10-22-16)11-3-1-5-13(7-11)17(20)21/h1-9H,10H2,(H,20,21).
What are the key properties of 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid?
3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid has a molecular weight of 358.19 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(3-bromophenyl)-2H-1,4-oxazin-3-yl]benzoic acid is sourced from PubChem (CID 143217439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).