About bis[3-(3-bromophenyl)phenyl]methanone;methane
bis[3-(3-bromophenyl)phenyl]methanone;methane (PubChem CID 158177415) has the molecular formula C26H20Br2O
and a molecular weight of 508.25 g/mol. Its IUPAC name is bis[3-(3-bromophenyl)phenyl]methanone;methane.
Molecular Properties
| Compound Name | bis[3-(3-bromophenyl)phenyl]methanone;methane |
| PubChem CID | 158177415 |
| Molecular Formula | C26H20Br2O |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | bis[3-(3-bromophenyl)phenyl]methanone;methane |
| SMILES | C.O=C(c1cccc(-c2cccc(Br)c2)c1)c1cccc(-c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C25H16Br2O.CH4/c26-23-11-3-7-19(15-23)17-5-1-9-21(13-17)25(28)22-10-2-6-18(14-22)20-8-4-12-24(27)16-20;/h1-16H;1H4 |
| InChIKey | FYDYNZNYNCGJNF-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis[3-(3-bromophenyl)phenyl]methanone;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(3-bromophenyl)phenyl]methanone;methane?
The IUPAC name of bis[3-(3-bromophenyl)phenyl]methanone;methane (CID 158177415) is bis[3-(3-bromophenyl)phenyl]methanone;methane.
What is the SMILES notation for bis[3-(3-bromophenyl)phenyl]methanone;methane?
The canonical SMILES for bis[3-(3-bromophenyl)phenyl]methanone;methane is C.O=C(c1cccc(-c2cccc(Br)c2)c1)c1cccc(-c2cccc(Br)c2)c1.
What is the InChIKey of bis[3-(3-bromophenyl)phenyl]methanone;methane?
The InChIKey is FYDYNZNYNCGJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16Br2O.CH4/c26-23-11-3-7-19(15-23)17-5-1-9-21(13-17)25(28)22-10-2-6-18(14-22)20-8-4-12-24(27)16-20;/h1-16H;1H4.
What are the key properties of bis[3-(3-bromophenyl)phenyl]methanone;methane?
bis[3-(3-bromophenyl)phenyl]methanone;methane has a molecular weight of 508.25 g/mol, XLogP of 8.41, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(3-bromophenyl)phenyl]methanone;methane is sourced from PubChem (CID 158177415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).