C23H13Br3O2 — CID 15437557
[3,5-bis(3-bromophenyl)furan-2-yl]-(3-bromophenyl)methanone (PubChem CID 15437557) has the molecular formula C23H13Br3O2 and a molecular weight of 561.07 g/mol. Its IUPAC name is [3,5-bis(3-bromophenyl)furan-2-yl]-(3-bromophenyl)methanone.
| Compound Name | [3,5-bis(3-bromophenyl)furan-2-yl]-(3-bromophenyl)methanone |
|---|---|
| PubChem CID | 15437557 |
| Molecular Formula | C23H13Br3O2 |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 557.85 |
| IUPAC Name | [3,5-bis(3-bromophenyl)furan-2-yl]-(3-bromophenyl)methanone |
| SMILES | O=C(c1cccc(Br)c1)c1oc(-c2cccc(Br)c2)cc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C23H13Br3O2/c24-17-7-1-4-14(10-17)20-13-21(15-5-2-8-18(25)11-15)28-23(20)22(27)16-6-3-9-19(26)12-16/h1-13H |
| InChIKey | YZXVRBARVOJTBF-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |