About (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone
(3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone (PubChem CID 134110047) has the molecular formula C11H6Br3NO
and a molecular weight of 407.89 g/mol. Its IUPAC name is (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone |
| PubChem CID | 134110047 |
| Molecular Formula | C11H6Br3NO |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 404.80 |
| IUPAC Name | (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1cccc(Br)c1)c1cc(Br)c(Br)[nH]1 |
| InChI | InChI=1S/C11H6Br3NO/c12-7-3-1-2-6(4-7)10(16)9-5-8(13)11(14)15-9/h1-5,15H |
| InChIKey | LRFWOBKDAYRIMA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone?
The IUPAC name of (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone (CID 134110047) is (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone.
What is the SMILES notation for (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone?
The canonical SMILES for (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone is O=C(c1cccc(Br)c1)c1cc(Br)c(Br)[nH]1.
What is the InChIKey of (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone?
The InChIKey is LRFWOBKDAYRIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Br3NO/c12-7-3-1-2-6(4-7)10(16)9-5-8(13)11(14)15-9/h1-5,15H.
What are the key properties of (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone?
(3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone has a molecular weight of 407.89 g/mol, XLogP of 4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone is sourced from PubChem (CID 134110047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).