C11H6Br3NO — CID 134110047
(3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone (PubChem CID 134110047) has the molecular formula C11H6Br3NO and a molecular weight of 407.89 g/mol. Its IUPAC name is (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone.
| Compound Name | (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 134110047 |
| Molecular Formula | C11H6Br3NO |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 404.80 |
| IUPAC Name | (3-bromophenyl)-(4,5-dibromo-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1cccc(Br)c1)c1cc(Br)c(Br)[nH]1 |
| InChI | InChI=1S/C11H6Br3NO/c12-7-3-1-2-6(4-7)10(16)9-5-8(13)11(14)15-9/h1-5,15H |
| InChIKey | LRFWOBKDAYRIMA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |