C17H10BrF2NO — CID 90645643
(3-bromophenyl)-[4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]methanone (PubChem CID 90645643) has the molecular formula C17H10BrF2NO and a molecular weight of 362.17 g/mol. Its IUPAC name is (3-bromophenyl)-[4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]methanone.
| Compound Name | (3-bromophenyl)-[4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 90645643 |
| Molecular Formula | C17H10BrF2NO |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | (3-bromophenyl)-[4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]methanone |
| SMILES | O=C(c1cccc(Br)c1)c1c[nH]cc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H10BrF2NO/c18-12-3-1-2-11(6-12)17(22)14-9-21-8-13(14)10-4-5-15(19)16(20)7-10/h1-9,21H |
| InChIKey | HPRICTKKVYHOKK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |