C17H10F2N2O3 — CID 90645743
[4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]-(2-nitrophenyl)methanone (PubChem CID 90645743) has the molecular formula C17H10F2N2O3 and a molecular weight of 328.27 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]-(2-nitrophenyl)methanone.
| Compound Name | [4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90645743 |
| Molecular Formula | C17H10F2N2O3 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [4-(3,4-difluorophenyl)-1H-pyrrol-3-yl]-(2-nitrophenyl)methanone |
| SMILES | O=C(c1c[nH]cc1-c1ccc(F)c(F)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10F2N2O3/c18-14-6-5-10(7-15(14)19)12-8-20-9-13(12)17(22)11-3-1-2-4-16(11)21(23)24/h1-9,20H |
| InChIKey | LXKDWIHRSXXCNY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|