C17H12ClNO2 — CID 118129528
3-[4-(7-chloro-2H-1,4-benzoxazin-3-yl)phenyl]prop-2-yn-1-ol (PubChem CID 118129528) has the molecular formula C17H12ClNO2 and a molecular weight of 297.74 g/mol. Its IUPAC name is 3-[4-(7-chloro-2H-1,4-benzoxazin-3-yl)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-(7-chloro-2H-1,4-benzoxazin-3-yl)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 118129528 |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-[4-(7-chloro-2H-1,4-benzoxazin-3-yl)phenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc(C2=Nc3ccc(Cl)cc3OC2)cc1 |
| InChI | InChI=1S/C17H12ClNO2/c18-14-7-8-15-17(10-14)21-11-16(19-15)13-5-3-12(4-6-13)2-1-9-20/h3-8,10,20H,9,11H2 |
| InChIKey | OSRUHWRHIKOWTM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|