C20H14ClNO — CID 91809172
7-chloro-3-(4-phenylphenyl)-2H-1,4-benzoxazine (PubChem CID 91809172) has the molecular formula C20H14ClNO and a molecular weight of 319.79 g/mol. Its IUPAC name is 7-chloro-3-(4-phenylphenyl)-2H-1,4-benzoxazine.
| Compound Name | 7-chloro-3-(4-phenylphenyl)-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 91809172 |
| Molecular Formula | C20H14ClNO |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 7-chloro-3-(4-phenylphenyl)-2H-1,4-benzoxazine |
| SMILES | Clc1ccc2c(c1)OCC(c1ccc(-c3ccccc3)cc1)=N2 |
| InChI | InChI=1S/C20H14ClNO/c21-17-10-11-18-20(12-17)23-13-19(22-18)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12H,13H2 |
| InChIKey | RJFBVAUZKPHMJI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |