C30H32Si3 — CID 177288427
2,2-dimethyl-1,1,3,3-tetraphenyl-4,7-dihydrotrisilepine (PubChem CID 177288427) has the molecular formula C30H32Si3 and a molecular weight of 476.84 g/mol. Its IUPAC name is 2,2-dimethyl-1,1,3,3-tetraphenyl-4,7-dihydrotrisilepine.
| Compound Name | 2,2-dimethyl-1,1,3,3-tetraphenyl-4,7-dihydrotrisilepine |
|---|---|
| PubChem CID | 177288427 |
| Molecular Formula | C30H32Si3 |
| Molecular Weight | 476.84 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2,2-dimethyl-1,1,3,3-tetraphenyl-4,7-dihydrotrisilepine |
| SMILES | C[Si]1(C)[Si](c2ccccc2)(c2ccccc2)CC=CC[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32Si3/c1-31(2)32(27-17-7-3-8-18-27,28-19-9-4-10-20-28)25-15-16-26-33(31,29-21-11-5-12-22-29)30-23-13-6-14-24-30/h3-24H,25-26H2,1-2H3 |
| InChIKey | LMRMBRHUTYNAEK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|