C45H48Si3 — CID 102463590
3,11,19-trimethyl-3,11,19-triphenyl-3,11,19-trisilatetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene (PubChem CID 102463590) has the molecular formula C45H48Si3 and a molecular weight of 673.14 g/mol. Its IUPAC name is 3,11,19-trimethyl-3,11,19-triphenyl-3,11,19-trisilatetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene.
| Compound Name | 3,11,19-trimethyl-3,11,19-triphenyl-3,11,19-trisilatetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene |
|---|---|
| PubChem CID | 102463590 |
| Molecular Formula | C45H48Si3 |
| Molecular Weight | 673.14 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | 3,11,19-trimethyl-3,11,19-triphenyl-3,11,19-trisilatetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene |
| SMILES | C[Si]1(c2ccccc2)Cc2cccc(c2)C[Si](C)(c2ccccc2)Cc2cccc(c2)C[Si](C)(c2ccccc2)Cc2cccc(c2)C1 |
| InChI | InChI=1S/C45H48Si3/c1-46(43-22-7-4-8-23-43)31-37-16-13-18-39(28-37)33-47(2,44-24-9-5-10-25-44)35-41-20-15-21-42(30-41)36-48(3,45-26-11-6-12-27-45)34-40-19-14-17-38(29-40)32-46/h4-30H,31-36H2,1-3H3 |
| InChIKey | HWCHRUXLPKCHPG-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.14 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|