C40H36Sn2 — CID 177448314
3,3,11,11-tetraphenyl-3,11-distannatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene (PubChem CID 177448314) has the molecular formula C40H36Sn2 and a molecular weight of 754.15 g/mol. Its IUPAC name is 3,3,11,11-tetraphenyl-3,11-distannatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene.
| Compound Name | 3,3,11,11-tetraphenyl-3,11-distannatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene |
|---|---|
| PubChem CID | 177448314 |
| Molecular Formula | C40H36Sn2 |
| Molecular Weight | 754.15 g/mol |
| Exact Mass | 756.09 |
| IUPAC Name | 3,3,11,11-tetraphenyl-3,11-distannatricyclo[11.3.1.15,9]octadeca-1(17),5(18),6,8,13,15-hexaene |
| SMILES | c1ccc([Sn]2(c3ccccc3)Cc3cccc(c3)C[Sn](c3ccccc3)(c3ccccc3)Cc3cccc(c3)C2)cc1 |
| InChI | InChI=1S/2C8H8.4C6H5.2Sn/c2*1-7-4-3-5-8(2)6-7;4*1-2-4-6-5-3-1;;/h2*3-6H,1-2H2;4*1-5H;; |
| InChIKey | NTDXOZDCZCAHRG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.15 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |