C15H32Si5 — CID 13004938
1,1,2,2,3,3,4,4,5-nonamethyl-5-phenylpentasilolane (PubChem CID 13004938) has the molecular formula C15H32Si5 and a molecular weight of 352.85 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5-nonamethyl-5-phenylpentasilolane.
| Compound Name | 1,1,2,2,3,3,4,4,5-nonamethyl-5-phenylpentasilolane |
|---|---|
| PubChem CID | 13004938 |
| Molecular Formula | C15H32Si5 |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5-nonamethyl-5-phenylpentasilolane |
| SMILES | C[Si]1(C)[Si](C)(C)[Si](C)(C)[Si](C)(c2ccccc2)[Si]1(C)C |
| InChI | InChI=1S/C15H32Si5/c1-16(2)17(3,4)19(7,8)20(9,18(16,5)6)15-13-11-10-12-14-15/h10-14H,1-9H3 |
| InChIKey | UKQPIYWCGVLZLT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|