C28H36N4Si4 — CID 12550610
2,2,6,6-tetramethyl-4,4,8,8-tetraphenyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane (PubChem CID 12550610) has the molecular formula C28H36N4Si4 and a molecular weight of 540.97 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4,4,8,8-tetraphenyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane.
| Compound Name | 2,2,6,6-tetramethyl-4,4,8,8-tetraphenyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane |
|---|---|
| PubChem CID | 12550610 |
| Molecular Formula | C28H36N4Si4 |
| Molecular Weight | 540.97 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 2,2,6,6-tetramethyl-4,4,8,8-tetraphenyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane |
| SMILES | C[Si]1(C)N[Si](c2ccccc2)(c2ccccc2)N[Si](C)(C)N[Si](c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C28H36N4Si4/c1-33(2)29-35(25-17-9-5-10-18-25,26-19-11-6-12-20-26)31-34(3,4)32-36(30-33,27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24,29-32H,1-4H3 |
| InChIKey | YNOZKSPILZAVEV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.97 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|