C11H20S2Si3 — CID 101044204
2,4,4,5,5-pentamethyl-2-phenyl-1,3,2,4,5-dithiatrisilolane (PubChem CID 101044204) has the molecular formula C11H20S2Si3 and a molecular weight of 300.67 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethyl-2-phenyl-1,3,2,4,5-dithiatrisilolane.
| Compound Name | 2,4,4,5,5-pentamethyl-2-phenyl-1,3,2,4,5-dithiatrisilolane |
|---|---|
| PubChem CID | 101044204 |
| Molecular Formula | C11H20S2Si3 |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2,4,4,5,5-pentamethyl-2-phenyl-1,3,2,4,5-dithiatrisilolane |
| SMILES | C[Si]1(c2ccccc2)S[Si](C)(C)[Si](C)(C)S1 |
| InChI | InChI=1S/C11H20S2Si3/c1-14(2)12-16(5,13-15(14,3)4)11-9-7-6-8-10-11/h6-10H,1-5H3 |
| InChIKey | DLDWOQQCCRUALM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|