C12H20S2Si2 — CID 71325110
2-ethyl-2-methyl-6-phenyl-6-sulfanyl-1,2,6-thiadisilinane (PubChem CID 71325110) has the molecular formula C12H20S2Si2 and a molecular weight of 284.60 g/mol. Its IUPAC name is 2-ethyl-2-methyl-6-phenyl-6-sulfanyl-1,2,6-thiadisilinane.
| Compound Name | 2-ethyl-2-methyl-6-phenyl-6-sulfanyl-1,2,6-thiadisilinane |
|---|---|
| PubChem CID | 71325110 |
| Molecular Formula | C12H20S2Si2 |
| Molecular Weight | 284.60 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-ethyl-2-methyl-6-phenyl-6-sulfanyl-1,2,6-thiadisilinane |
| SMILES | CC[Si]1(C)CCC[Si](S)(c2ccccc2)S1 |
| InChI | InChI=1S/C12H20S2Si2/c1-3-15(2)10-7-11-16(13,14-15)12-8-5-4-6-9-12/h4-6,8-9,13H,3,7,10-11H2,1-2H3 |
| InChIKey | QSYYUOLILWHMLA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|