C21H27N3Si3 — CID 173449178
1,2,3-trimethyl-2,4,6-triphenyl-1,3,5,2,4,6-triazatrisilinane (PubChem CID 173449178) has the molecular formula C21H27N3Si3 and a molecular weight of 405.73 g/mol. Its IUPAC name is 1,2,3-trimethyl-2,4,6-triphenyl-1,3,5,2,4,6-triazatrisilinane.
| Compound Name | 1,2,3-trimethyl-2,4,6-triphenyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| PubChem CID | 173449178 |
| Molecular Formula | C21H27N3Si3 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1,2,3-trimethyl-2,4,6-triphenyl-1,3,5,2,4,6-triazatrisilinane |
| SMILES | CN1[SiH](c2ccccc2)N[SiH](c2ccccc2)N(C)[Si]1(C)c1ccccc1 |
| InChI | InChI=1S/C21H27N3Si3/c1-23-25(19-13-7-4-8-14-19)22-26(20-15-9-5-10-16-20)24(2)27(23,3)21-17-11-6-12-18-21/h4-18,22,25-26H,1-3H3 |
| InChIKey | WKNZMYRUHSKEJA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|