C66H56Si6 — CID 71366879
1,1,2,2,3,3,4,4,5,5,6-undecakis-phenylhexasilinane (PubChem CID 71366879) has the molecular formula C66H56Si6 and a molecular weight of 1017.69 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecakis-phenylhexasilinane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecakis-phenylhexasilinane |
|---|---|
| PubChem CID | 71366879 |
| Molecular Formula | C66H56Si6 |
| Molecular Weight | 1017.69 g/mol |
| Exact Mass | 1016.30 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecakis-phenylhexasilinane |
| SMILES | c1ccc([SiH]2[Si](c3ccccc3)(c3ccccc3)[Si](c3ccccc3)(c3ccccc3)[Si](c3ccccc3)(c3ccccc3)[Si](c3ccccc3)(c3ccccc3)[Si]2(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C66H56Si6/c1-12-34-56(35-13-1)67-68(57-36-14-2-15-37-57,58-38-16-3-17-39-58)70(61-44-22-6-23-45-61,62-46-24-7-25-47-62)72(65-52-30-10-31-53-65,66-54-32-11-33-55-66)71(63-48-26-8-27-49-63,64-50-28-9-29-51-64)69(67,59-40-18-4-19-41-59)60-42-20-5-21-43-60/h1-55,67H |
| InChIKey | RQWRPVMZVYQECQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.69 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|