C52H52Si5 — CID 173104885
diethylsilane;1,1,2,2,3,3,4,4-octakis-phenyltetrasiletane (PubChem CID 173104885) has the molecular formula C52H52Si5 and a molecular weight of 817.42 g/mol. Its IUPAC name is diethylsilane;1,1,2,2,3,3,4,4-octakis-phenyltetrasiletane.
| Compound Name | diethylsilane;1,1,2,2,3,3,4,4-octakis-phenyltetrasiletane |
|---|---|
| PubChem CID | 173104885 |
| Molecular Formula | C52H52Si5 |
| Molecular Weight | 817.42 g/mol |
| Exact Mass | 816.29 |
| IUPAC Name | diethylsilane;1,1,2,2,3,3,4,4-octakis-phenyltetrasiletane |
| SMILES | CC[SiH2]CC.c1ccc([Si]2(c3ccccc3)[Si](c3ccccc3)(c3ccccc3)[Si](c3ccccc3)(c3ccccc3)[Si]2(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H40Si4.C4H12Si/c1-9-25-41(26-10-1)49(42-27-11-2-12-28-42)50(43-29-13-3-14-30-43,44-31-15-4-16-32-44)52(47-37-21-7-22-38-47,48-39-23-8-24-40-48)51(49,45-33-17-5-18-34-45)46-35-19-6-20-36-46;1-3-5-4-2/h1-40H;3-5H2,1-2H3 |
| InChIKey | BWQDAMWNQUFLCL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|