About 3-phenyldioxasilirane
3-phenyldioxasilirane (PubChem CID 173414769) has the molecular formula C6H6O2Si
and a molecular weight of 138.20 g/mol. Its IUPAC name is 3-phenyldioxasilirane.
Molecular Properties
| Compound Name | 3-phenyldioxasilirane |
| PubChem CID | 173414769 |
| Molecular Formula | C6H6O2Si |
| Molecular Weight | 138.20 g/mol |
| Exact Mass | 138.01 |
| IUPAC Name | 3-phenyldioxasilirane |
| SMILES | c1ccc([SiH]2OO2)cc1 |
| InChI | InChI=1S/C6H6O2Si/c1-2-4-6(5-3-1)9-7-8-9/h1-5,9H |
| InChIKey | IMOFPVMTQFNSJR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyldioxasilirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyldioxasilirane?
The IUPAC name of 3-phenyldioxasilirane (CID 173414769) is 3-phenyldioxasilirane.
What is the SMILES notation for 3-phenyldioxasilirane?
The canonical SMILES for 3-phenyldioxasilirane is c1ccc([SiH]2OO2)cc1.
What is the InChIKey of 3-phenyldioxasilirane?
The InChIKey is IMOFPVMTQFNSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2Si/c1-2-4-6(5-3-1)9-7-8-9/h1-5,9H.
What are the key properties of 3-phenyldioxasilirane?
3-phenyldioxasilirane has a molecular weight of 138.20 g/mol, XLogP of 0.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyldioxasilirane is sourced from PubChem (CID 173414769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).