C6H8O2Si2 — CID 123360837
2-phenyl-1,3,2,4-dioxadisiletane (PubChem CID 123360837) has the molecular formula C6H8O2Si2 and a molecular weight of 168.30 g/mol. Its IUPAC name is 2-phenyl-1,3,2,4-dioxadisiletane.
| Compound Name | 2-phenyl-1,3,2,4-dioxadisiletane |
|---|---|
| PubChem CID | 123360837 |
| Molecular Formula | C6H8O2Si2 |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 2-phenyl-1,3,2,4-dioxadisiletane |
| SMILES | c1ccc([SiH]2O[SiH2]O2)cc1 |
| InChI | InChI=1S/C6H8O2Si2/c1-2-4-6(5-3-1)10-7-9-8-10/h1-5,10H,9H2 |
| InChIKey | XZPDUJLBICAVRX-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|