C7H12O3Si3 — CID 154124600
2-(4-methylphenyl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 154124600) has the molecular formula C7H12O3Si3 and a molecular weight of 228.43 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-(4-methylphenyl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 154124600 |
| Molecular Formula | C7H12O3Si3 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(4-methylphenyl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | Cc1ccc([SiH]2O[SiH2]O[SiH2]O2)cc1 |
| InChI | InChI=1S/C7H12O3Si3/c1-6-2-4-7(5-3-6)13-9-11-8-12-10-13/h2-5,13H,11-12H2,1H3 |
| InChIKey | RMIRSVDHNAGZKF-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|