About benzene;2-phenyloxasilinane
benzene;2-phenyloxasilinane (PubChem CID 174878349) has the molecular formula C16H20OSi
and a molecular weight of 256.42 g/mol. Its IUPAC name is benzene;2-phenyloxasilinane.
Molecular Properties
| Compound Name | benzene;2-phenyloxasilinane |
| PubChem CID | 174878349 |
| Molecular Formula | C16H20OSi |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | benzene;2-phenyloxasilinane |
| SMILES | c1ccc([SiH]2CCCCO2)cc1.c1ccccc1 |
| InChI | InChI=1S/C10H14OSi.C6H6/c1-2-6-10(7-3-1)12-9-5-4-8-11-12;1-2-4-6-5-3-1/h1-3,6-7,12H,4-5,8-9H2;1-6H |
| InChIKey | YPWVOCSKDJUVJB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzene;2-phenyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-phenyloxasilinane?
The IUPAC name of benzene;2-phenyloxasilinane (CID 174878349) is benzene;2-phenyloxasilinane.
What is the SMILES notation for benzene;2-phenyloxasilinane?
The canonical SMILES for benzene;2-phenyloxasilinane is c1ccc([SiH]2CCCCO2)cc1.c1ccccc1.
What is the InChIKey of benzene;2-phenyloxasilinane?
The InChIKey is YPWVOCSKDJUVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14OSi.C6H6/c1-2-6-10(7-3-1)12-9-5-4-8-11-12;1-2-4-6-5-3-1/h1-3,6-7,12H,4-5,8-9H2;1-6H.
What are the key properties of benzene;2-phenyloxasilinane?
benzene;2-phenyloxasilinane has a molecular weight of 256.42 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-phenyloxasilinane is sourced from PubChem (CID 174878349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).