C12H24O4Si4 — CID 28342
2,2,4,4,6,6-hexamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 28342) has the molecular formula C12H24O4Si4 and a molecular weight of 344.66 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4,6,6-hexamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 28342 |
| Molecular Formula | C12H24O4Si4 |
| Molecular Weight | 344.66 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[SiH](c2ccccc2)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C12H24O4Si4/c1-18(2)13-17(12-10-8-7-9-11-12)14-19(3,4)16-20(5,6)15-18/h7-11,17H,1-6H3 |
| InChIKey | YMONUWOWOHUJNI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.66 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|