C25H37O4PSi4 — CID 175559013
2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;triphenylphosphane (PubChem CID 175559013) has the molecular formula C25H37O4PSi4 and a molecular weight of 544.89 g/mol. Its IUPAC name is 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;triphenylphosphane.
| Compound Name | 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;triphenylphosphane |
|---|---|
| PubChem CID | 175559013 |
| Molecular Formula | C25H37O4PSi4 |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;triphenylphosphane |
| SMILES | C[SiH]1O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C7H22O4Si4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-12-8-13(2,3)10-15(6,7)11-14(4,5)9-12/h1-15H;12H,1-7H3 |
| InChIKey | XHNCOJOHFMVBRD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|