C10H20O4Si4 — CID 123845404
2,2,4,4-tetramethyl-6-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 123845404) has the molecular formula C10H20O4Si4 and a molecular weight of 316.61 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4-tetramethyl-6-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 123845404 |
| Molecular Formula | C10H20O4Si4 |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[SiH2]O[SiH](c2ccccc2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H20O4Si4/c1-17(2)12-15-11-16(13-18(3,4)14-17)10-8-6-5-7-9-10/h5-9,16H,15H2,1-4H3 |
| InChIKey | PUIXOCDMEBDXHG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|