About chlorotitanium(1+);diphenylazanide
chlorotitanium(1+);diphenylazanide (PubChem CID 59831007) has the molecular formula C12H10ClNTi
and a molecular weight of 251.54 g/mol. Its IUPAC name is chlorotitanium(1+);diphenylazanide.
Molecular Properties
| Compound Name | chlorotitanium(1+);diphenylazanide |
| PubChem CID | 59831007 |
| Molecular Formula | C12H10ClNTi |
| Molecular Weight | 251.54 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | chlorotitanium(1+);diphenylazanide |
| SMILES | Cl[Ti+].c1ccc([N-]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N.ClH.Ti/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;1H;/q-1;;+2/p-1 |
| InChIKey | PWZVNBZLFCLKDT-UHFFFAOYSA-M |
| XLogP | 4.71 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chlorotitanium(1+);diphenylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorotitanium(1+);diphenylazanide?
The IUPAC name of chlorotitanium(1+);diphenylazanide (CID 59831007) is chlorotitanium(1+);diphenylazanide.
What is the SMILES notation for chlorotitanium(1+);diphenylazanide?
The canonical SMILES for chlorotitanium(1+);diphenylazanide is Cl[Ti+].c1ccc([N-]c2ccccc2)cc1.
What is the InChIKey of chlorotitanium(1+);diphenylazanide?
The InChIKey is PWZVNBZLFCLKDT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10N.ClH.Ti/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;1H;/q-1;;+2/p-1.
What are the key properties of chlorotitanium(1+);diphenylazanide?
chlorotitanium(1+);diphenylazanide has a molecular weight of 251.54 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorotitanium(1+);diphenylazanide is sourced from PubChem (CID 59831007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).