About anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium
anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium (PubChem CID 21130214) has the molecular formula C26H18Cl2N2Ti-2
and a molecular weight of 477.22 g/mol. Its IUPAC name is anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium.
Molecular Properties
| Compound Name | anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium |
| PubChem CID | 21130214 |
| Molecular Formula | C26H18Cl2N2Ti-2 |
| Molecular Weight | 477.22 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium |
| SMILES | Cl[Ti]Cl.c1ccc([N-]c2ccccc2[N-]c2c3ccccc3cc3ccccc23)cc1 |
| InChI | InChI=1S/C26H18N2.2ClH.Ti/c1-2-12-21(13-3-1)27-24-16-8-9-17-25(24)28-26-22-14-6-4-10-19(22)18-20-11-5-7-15-23(20)26;;;/h1-18H;2*1H;/q-2;;;+2/p-2 |
| InChIKey | MNDXJELDXRNSPX-UHFFFAOYSA-L |
| XLogP | 10.04 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.22 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium?
The IUPAC name of anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium (CID 21130214) is anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium.
What is the SMILES notation for anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium?
The canonical SMILES for anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium is Cl[Ti]Cl.c1ccc([N-]c2ccccc2[N-]c2c3ccccc3cc3ccccc23)cc1.
What is the InChIKey of anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium?
The InChIKey is MNDXJELDXRNSPX-UHFFFAOYSA-L. The full InChI is InChI=1S/C26H18N2.2ClH.Ti/c1-2-12-21(13-3-1)27-24-16-8-9-17-25(24)28-26-22-14-6-4-10-19(22)18-20-11-5-7-15-23(20)26;;;/h1-18H;2*1H;/q-2;;;+2/p-2.
What are the key properties of anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium?
anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium has a molecular weight of 477.22 g/mol, XLogP of 10.04, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-yl-(2-phenylazanidylphenyl)azanide;dichlorotitanium is sourced from PubChem (CID 21130214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).