About benzene;9-ethynylanthracene
benzene;9-ethynylanthracene (PubChem CID 161110556) has the molecular formula C22H16
and a molecular weight of 280.37 g/mol. Its IUPAC name is benzene;9-ethynylanthracene.
Molecular Properties
| Compound Name | benzene;9-ethynylanthracene |
| PubChem CID | 161110556 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | benzene;9-ethynylanthracene |
| SMILES | C#Cc1c2ccccc2cc2ccccc12.c1ccccc1 |
| InChI | InChI=1S/C16H10.C6H6/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14;1-2-4-6-5-3-1/h1,3-11H;1-6H |
| InChIKey | UJQFQNCVFWHROF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene;9-ethynylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;9-ethynylanthracene?
The IUPAC name of benzene;9-ethynylanthracene (CID 161110556) is benzene;9-ethynylanthracene.
What is the SMILES notation for benzene;9-ethynylanthracene?
The canonical SMILES for benzene;9-ethynylanthracene is C#Cc1c2ccccc2cc2ccccc12.c1ccccc1.
What is the InChIKey of benzene;9-ethynylanthracene?
The InChIKey is UJQFQNCVFWHROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C6H6/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14;1-2-4-6-5-3-1/h1,3-11H;1-6H.
What are the key properties of benzene;9-ethynylanthracene?
benzene;9-ethynylanthracene has a molecular weight of 280.37 g/mol, XLogP of 5.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;9-ethynylanthracene is sourced from PubChem (CID 161110556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).