About 1,2,3-triethynylnaphthalene
1,2,3-triethynylnaphthalene (PubChem CID 139963288) has the molecular formula C16H8
and a molecular weight of 200.24 g/mol. Its IUPAC name is 1,2,3-triethynylnaphthalene.
Molecular Properties
| Compound Name | 1,2,3-triethynylnaphthalene |
| PubChem CID | 139963288 |
| Molecular Formula | C16H8 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1,2,3-triethynylnaphthalene |
| SMILES | C#Cc1cc2ccccc2c(C#C)c1C#C |
| InChI | InChI=1S/C16H8/c1-4-12-11-13-9-7-8-10-16(13)15(6-3)14(12)5-2/h1-3,7-11H |
| InChIKey | QYSDZIZDKFGTPD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-triethynylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-triethynylnaphthalene?
The IUPAC name of 1,2,3-triethynylnaphthalene (CID 139963288) is 1,2,3-triethynylnaphthalene.
What is the SMILES notation for 1,2,3-triethynylnaphthalene?
The canonical SMILES for 1,2,3-triethynylnaphthalene is C#Cc1cc2ccccc2c(C#C)c1C#C.
What is the InChIKey of 1,2,3-triethynylnaphthalene?
The InChIKey is QYSDZIZDKFGTPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8/c1-4-12-11-13-9-7-8-10-16(13)15(6-3)14(12)5-2/h1-3,7-11H.
What are the key properties of 1,2,3-triethynylnaphthalene?
1,2,3-triethynylnaphthalene has a molecular weight of 200.24 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-triethynylnaphthalene is sourced from PubChem (CID 139963288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).