C14H8 — CID 139963204
1,3-diethynylnaphthalene (PubChem CID 139963204) has the molecular formula C14H8 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,3-diethynylnaphthalene.
| Compound Name | 1,3-diethynylnaphthalene |
|---|---|
| PubChem CID | 139963204 |
| Molecular Formula | C14H8 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1,3-diethynylnaphthalene |
| SMILES | C#Cc1cc(C#C)c2ccccc2c1 |
| InChI | InChI=1S/C14H8/c1-3-11-9-12(4-2)14-8-6-5-7-13(14)10-11/h1-2,5-10H |
| InChIKey | OBCVNKBZBIQTIE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|