C16H8 — CID 139963259
1,3,5-triethynylnaphthalene (PubChem CID 139963259) has the molecular formula C16H8 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1,3,5-triethynylnaphthalene.
| Compound Name | 1,3,5-triethynylnaphthalene |
|---|---|
| PubChem CID | 139963259 |
| Molecular Formula | C16H8 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1,3,5-triethynylnaphthalene |
| SMILES | C#Cc1cc(C#C)c2cccc(C#C)c2c1 |
| InChI | InChI=1S/C16H8/c1-4-12-10-14(6-3)15-9-7-8-13(5-2)16(15)11-12/h1-3,7-11H |
| InChIKey | VQBDBOSFEYOWIQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|